cas: 364750-80-1 — see every product listed under this CAS number, including other names
(2S,4R)-1-(tert-Butoxycarbonyl)-4-methylpyrrolidine-2-carboxylic acid, 97%, 97% (CAS 364750-80-1) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C7ZJ-50mg |
| cas | 364750-80-1 |
| size | 50mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 424.40 Pln | |
| Chemat | 100mg | 534.80 Pln | |
| Chemat | 250mg | 774.80 Pln | |
| Chemat | 1g | 1682.00 Pln | |
| Chemat | 5g | 4946.00 Pln | |
| Chemat | 10g | 7883.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2S,4R)-4-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (CAS 364750-80-1) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: (2S,4R)-4-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid. InChIKey: MXKSXPYZNXUHEZ-SFYZADRCSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | (2S,4R)-4-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | MXKSXPYZNXUHEZ-SFYZADRCSA-N |
| SMILES | C[C@@H]1C[C@H](N(C1)C(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)