CAS 2248372-39-4 appears in our catalog under these names: 3-{[(tert-butoxy)carbonyl]amino}-1-methylcyclobutane-1-carboxylic acid, 98%, 3-((tert-Butoxycarbonyl)amino)-1-methylcyclobutane-1-carboxylic acid, 97%, 3-{[(tert-butoxy)carbonyl]amino}-1-methylcyclobutane-1-carboxylic acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 250mg, 100mg, 5g, 500mg.
1-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylic acid (CAS 2248372-39-4) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: 1-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylic acid. InChIKey: YBRNATIEYPVMDD-UHFFFAOYSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | 1-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylic acid |
| InChIKey | YBRNATIEYPVMDD-UHFFFAOYSA-N |
| SMILES | CC1(CC(C1)NC(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)