CAS 161660-94-2 appears in our catalog under these names: (-)-(1R,3S)-N-Boc-3-aminocyclopentanecarboxylic acid, 98%, BOC–(1R,3S)–3–Aminocyclopentane carboxylic acid, (1R,3S)-(-)-3-(Boc-amino)cyclopentanecarboxylic acid, 95% , (1S,3R)-N-BOC-1-Aminocyclopentane-3-carboxylic acid, 95%, 98% ee, BOC-(1R,3S)-3-aminocyclopentane carboxylic acid 95%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Thermo Scientific (Acros), Ambeed. Available pack sizes: 1g, 10g, 25g, 5g, 50mg, 250MG, 100g, 500g.
Cis-(1R,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid (CAS 161660-94-2) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: cis-(1R,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid. InChIKey: RNJQBGXOSAQQDG-SFYZADRCSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | cis-(1R,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid |
| InChIKey | RNJQBGXOSAQQDG-SFYZADRCSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CC[C@H](C1)C(=O)O |
Computed by PubChem (NCBI)