cas: 1421253-08-8 — see every product listed under this CAS number, including other names
(2S,4R)-4-Methoxy-2-methylpiperidine hydrochloride, 97% (CAS 1421253-08-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 500mg, 1g, 10g. Offered by: AmBeed, Fluorochem, Chemat.
| brand | AmBeed |
|---|---|
| catalog number | A154431-5g |
| cas | 1421253-08-8 |
| size | 5g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 30875.32 Pln | |
| Fluorochem | 100mg | 1757.73 Pln | |
| Fluorochem | 250mg | 2767.79 Pln | |
| Fluorochem | 500mg | 4511.97 Pln | |
| Fluorochem | 1g | 6599.78 Pln | |
| Fluorochem | 5g | 19626.44 Pln | |
| Chemat | 100mg | 894.80 Pln | |
| Chemat | 250mg | 1398.80 Pln | |
| Chemat | 500mg | 2286.80 Pln | |
| Chemat | 1g | 3390.80 Pln | |
| Chemat | 5g | 10048.40 Pln | |
| Chemat | 10g | 17042.00 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
(2S,4R)-4-methoxy-2-methylpiperidine;hydrochloride (CAS 1421253-08-8) is a chemical compound with the molecular formula C7H16ClNO and a molecular weight of 165.66 g/mol. IUPAC name: (2S,4R)-4-methoxy-2-methylpiperidine;hydrochloride. InChIKey: KMVHXBYZLIKKMN-UOERWJHTSA-N.
| Molecular formula | C7H16ClNO |
|---|---|
| Molecular weight | 165.66 g/mol |
| IUPAC name | (2S,4R)-4-methoxy-2-methylpiperidine;hydrochloride |
| InChIKey | KMVHXBYZLIKKMN-UOERWJHTSA-N |
| SMILES | C[C@H]1C[C@@H](CCN1)OC.Cl |
Computed by PubChem (NCBI)