CAS 1621225-22-6 is the registry number for rac-(2R,4R)-4-Methoxy-2-methylpiperidine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(2R,4R)-4-methoxy-2-methylpiperidine;hydrochloride (CAS 1621225-22-6) is a chemical compound with the molecular formula C7H16ClNO and a molecular weight of 165.66 g/mol. IUPAC name: (2R,4R)-4-methoxy-2-methylpiperidine;hydrochloride. InChIKey: KMVHXBYZLIKKMN-ZJLYAJKPSA-N.
| Molecular formula | C7H16ClNO |
|---|---|
| Molecular weight | 165.66 g/mol |
| IUPAC name | (2R,4R)-4-methoxy-2-methylpiperidine;hydrochloride |
| InChIKey | KMVHXBYZLIKKMN-ZJLYAJKPSA-N |
| SMILES | C[C@@H]1C[C@@H](CCN1)OC.Cl |
Computed by PubChem (NCBI)