CAS 1421253-06-6 is the registry number for (2R,4S)-4-methoxy-2-methyl-piperidine,hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
(2R,4S)-4-methoxy-2-methylpiperidine;hydrochloride (CAS 1421253-06-6) is a chemical compound with the molecular formula C7H16ClNO and a molecular weight of 165.66 g/mol. IUPAC name: (2R,4S)-4-methoxy-2-methylpiperidine;hydrochloride. InChIKey: KMVHXBYZLIKKMN-HHQFNNIRSA-N.
| Molecular formula | C7H16ClNO |
|---|---|
| Molecular weight | 165.66 g/mol |
| IUPAC name | (2R,4S)-4-methoxy-2-methylpiperidine;hydrochloride |
| InChIKey | KMVHXBYZLIKKMN-HHQFNNIRSA-N |
| SMILES | C[C@@H]1C[C@H](CCN1)OC.Cl |
Computed by PubChem (NCBI)