cas: 62147-27-7 — see every product listed under this CAS number, including other names
(2S,4R)-Benzyl 4-hydroxypyrrolidine-2-carboxylate hydrochloride, 98%, 98% (CAS 62147-27-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1143CG-1g |
| cas | 62147-27-7 |
| size | 1g |
| availability | 1500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 93.20 Pln | |
| Chemat | 10g | 126.80 Pln | |
| Chemat | 25g | 208.40 Pln | |
| Chemat | 50g | 333.20 Pln | |
| Chemat | 100g | 549.20 Pln | |
| Chemat | 250g | 1278.80 Pln | |
| Chemat | 500g | 2462.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Benzyl (2S,4R)-4-hydroxypyrrolidine-2-carboxylate;hydrochloride (CAS 62147-27-7) is a chemical compound with the molecular formula C12H16ClNO3 and a molecular weight of 257.71 g/mol. IUPAC name: benzyl (2S,4R)-4-hydroxypyrrolidine-2-carboxylate;hydrochloride. InChIKey: LVYXMDJSWLEZMP-DHXVBOOMSA-N.
| Molecular formula | C12H16ClNO3 |
|---|---|
| Molecular weight | 257.71 g/mol |
| IUPAC name | benzyl (2S,4R)-4-hydroxypyrrolidine-2-carboxylate;hydrochloride |
| InChIKey | LVYXMDJSWLEZMP-DHXVBOOMSA-N |
| SMILES | C1[C@H](CN[C@@H]1C(=O)OCC2=CC=CC=C2)O.Cl |
Computed by PubChem (NCBI)