CAS 1207894-63-0 appears in our catalog under these names: 1-Amino-3-(benzyloxy)cyclobutanecarboxylic acid hydrochloride, 95%, 1-Amino-3-(benzyloxy)cyclobutanecarboxylic acid hydrochloride, 95%, 95%. Offered by: Combi-blocks, Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
1-amino-3-phenylmethoxycyclobutane-1-carboxylic acid;hydrochloride (CAS 1207894-63-0) is a chemical compound with the molecular formula C12H16ClNO3 and a molecular weight of 257.71 g/mol. IUPAC name: 1-amino-3-phenylmethoxycyclobutane-1-carboxylic acid;hydrochloride. InChIKey: HFBBBUVKBSKCRI-UHFFFAOYSA-N.
| Molecular formula | C12H16ClNO3 |
|---|---|
| Molecular weight | 257.71 g/mol |
| IUPAC name | 1-amino-3-phenylmethoxycyclobutane-1-carboxylic acid;hydrochloride |
| InChIKey | HFBBBUVKBSKCRI-UHFFFAOYSA-N |
| SMILES | C1C(CC1(C(=O)O)N)OCC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)