CAS 1803592-22-4 appears in our catalog under these names: 3-(2,3-Dihydro-1h-isoindol-2-yl)-2-hydroxy-2-methylpropanoic acid hydrochloride, 95%, 3-(2,3-Dihydro-1H-isoindol-2-yl)-2-hydroxy-2-methylpropanoic acid hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 250mg, 0,5g, 50mg.
3-(1,3-dihydroisoindol-2-yl)-2-hydroxy-2-methylpropanoic acid;hydrochloride (CAS 1803592-22-4) is a chemical compound with the molecular formula C12H16ClNO3 and a molecular weight of 257.71 g/mol. IUPAC name: 3-(1,3-dihydroisoindol-2-yl)-2-hydroxy-2-methylpropanoic acid;hydrochloride. InChIKey: RKJJEXSNLRIUEO-UHFFFAOYSA-N.
| Molecular formula | C12H16ClNO3 |
|---|---|
| Molecular weight | 257.71 g/mol |
| IUPAC name | 3-(1,3-dihydroisoindol-2-yl)-2-hydroxy-2-methylpropanoic acid;hydrochloride |
| InChIKey | RKJJEXSNLRIUEO-UHFFFAOYSA-N |
| SMILES | CC(CN1CC2=CC=CC=C2C1)(C(=O)O)O.Cl |
Computed by PubChem (NCBI)