cas: 175671-43-9 — see every product listed under this CAS number, including other names
(2S,4R)-Methyl 4-hydroxypiperidine-2-carboxylate hydrochloride, 95%, 95% (CAS 175671-43-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ANUT-1g |
| cas | 175671-43-9 |
| size | 1g |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 2920.40 Pln | |
| Chemat | 5g | 8618.00 Pln | |
| Chemat | 10g | 14315.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl (2S,4R)-4-hydroxypiperidine-2-carboxylate;hydrochloride (CAS 175671-43-9) is a chemical compound with the molecular formula C7H14ClNO3 and a molecular weight of 195.64 g/mol. IUPAC name: methyl (2S,4R)-4-hydroxypiperidine-2-carboxylate;hydrochloride. InChIKey: ZZQYALUPYHIFSA-IBTYICNHSA-N.
| Molecular formula | C7H14ClNO3 |
|---|---|
| Molecular weight | 195.64 g/mol |
| IUPAC name | methyl (2S,4R)-4-hydroxypiperidine-2-carboxylate;hydrochloride |
| InChIKey | ZZQYALUPYHIFSA-IBTYICNHSA-N |
| SMILES | COC(=O)[C@@H]1C[C@@H](CCN1)O.Cl |
Computed by PubChem (NCBI)