cas: 175671-43-9 — see every product listed under this CAS number, including other names
(2S,4R)-Methyl 4-hydroxypiperidine-2-carboxylate hydrochloride, 98+% (CAS 175671-43-9) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A289023-10g |
| cas | 175671-43-9 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 24593.17 Pln | |
| AmBeed | 5g | 14789.11 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
Methyl (2S,4R)-4-hydroxypiperidine-2-carboxylate;hydrochloride (CAS 175671-43-9) is a chemical compound with the molecular formula C7H14ClNO3 and a molecular weight of 195.64 g/mol. IUPAC name: methyl (2S,4R)-4-hydroxypiperidine-2-carboxylate;hydrochloride. InChIKey: ZZQYALUPYHIFSA-IBTYICNHSA-N.
| Molecular formula | C7H14ClNO3 |
|---|---|
| Molecular weight | 195.64 g/mol |
| IUPAC name | methyl (2S,4R)-4-hydroxypiperidine-2-carboxylate;hydrochloride |
| InChIKey | ZZQYALUPYHIFSA-IBTYICNHSA-N |
| SMILES | COC(=O)[C@@H]1C[C@@H](CCN1)O.Cl |
Computed by PubChem (NCBI)