cas: 57653-35-7 — see every product listed under this CAS number, including other names
(2S,4S)–1–(Benzyloxycarbonyl)–2–(methoxycarbonyl)–4–hydroxypyrrolidine (CAS 57653-35-7) is a chemical reagent available from Chemat. Available pack sizes: 100g, 10g, 1g, 25g, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GB50839-100g |
| cas | 57653-35-7 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100g | 3868.71 Pln | |
| GLPBio | 10g | 976.16 Pln | |
| GLPBio | 1g | 512.79 Pln | |
| GLPBio | 25g | 1500.38 Pln | |
| GLPBio | 5g | 728.09 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
1-O-benzyl 2-O-methyl (2S,4S)-4-hydroxypyrrolidine-1,2-dicarboxylate (CAS 57653-35-7) is a chemical compound with the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. IUPAC name: 1-O-benzyl 2-O-methyl (2S,4S)-4-hydroxypyrrolidine-1,2-dicarboxylate. InChIKey: VVKAGQHUUDRPOI-RYUDHWBXSA-N.
| Molecular formula | C14H17NO5 |
|---|---|
| Molecular weight | 279.29 g/mol |
| IUPAC name | 1-O-benzyl 2-O-methyl (2S,4S)-4-hydroxypyrrolidine-1,2-dicarboxylate |
| InChIKey | VVKAGQHUUDRPOI-RYUDHWBXSA-N |
| SMILES | COC(=O)[C@@H]1C[C@@H](CN1C(=O)OCC2=CC=CC=C2)O |
Computed by PubChem (NCBI)