cas: 57653-35-7 — see every product listed under this CAS number, including other names
1,2-Pyrrolidinedicarboxylic acid, 4-hydroxy-, 2-methyl 1-(phenylmethyl) ester, (2S,4S)-, 98%, 98% (CAS 57653-35-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EJ8U-250mg |
| cas | 57653-35-7 |
| size | 250mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 141.20 Pln | |
| Chemat | 5g | 304.40 Pln | |
| Chemat | 10g | 491.60 Pln | |
| Chemat | 25g | 928.40 Pln | |
| Chemat | 100g | 2771.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-O-benzyl 2-O-methyl (2S,4S)-4-hydroxypyrrolidine-1,2-dicarboxylate (CAS 57653-35-7) is a chemical compound with the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. IUPAC name: 1-O-benzyl 2-O-methyl (2S,4S)-4-hydroxypyrrolidine-1,2-dicarboxylate. InChIKey: VVKAGQHUUDRPOI-RYUDHWBXSA-N.
| Molecular formula | C14H17NO5 |
|---|---|
| Molecular weight | 279.29 g/mol |
| IUPAC name | 1-O-benzyl 2-O-methyl (2S,4S)-4-hydroxypyrrolidine-1,2-dicarboxylate |
| InChIKey | VVKAGQHUUDRPOI-RYUDHWBXSA-N |
| SMILES | COC(=O)[C@@H]1C[C@@H](CN1C(=O)OCC2=CC=CC=C2)O |
Computed by PubChem (NCBI)