cas: 57653-35-7 — see every product listed under this CAS number, including other names
(2S,4S)-1-Benzyl 2-methyl 4-hydroxypyrrolidine-1,2-dicarboxylate, 98% (CAS 57653-35-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F465091-5G |
| cas | 57653-35-7 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 299.91 Pln | |
| Fluorochem | 10g | 487.35 Pln | |
| Fluorochem | 25g | 950.72 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-O-benzyl 2-O-methyl (2S,4S)-4-hydroxypyrrolidine-1,2-dicarboxylate (CAS 57653-35-7) is a chemical compound with the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. IUPAC name: 1-O-benzyl 2-O-methyl (2S,4S)-4-hydroxypyrrolidine-1,2-dicarboxylate. InChIKey: VVKAGQHUUDRPOI-RYUDHWBXSA-N.
| Molecular formula | C14H17NO5 |
|---|---|
| Molecular weight | 279.29 g/mol |
| IUPAC name | 1-O-benzyl 2-O-methyl (2S,4S)-4-hydroxypyrrolidine-1,2-dicarboxylate |
| InChIKey | VVKAGQHUUDRPOI-RYUDHWBXSA-N |
| SMILES | COC(=O)[C@@H]1C[C@@H](CN1C(=O)OCC2=CC=CC=C2)O |
Computed by PubChem (NCBI)