(3,4,5-Trichlorophenyl)boronic acid, 95%
cas: 862248-93-9 — see every product listed under this CAS number, including other names
(3,4,5-Trichlorophenyl)boronic acid, 95% (CAS 862248-93-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A223655-250mg |
| cas | 862248-93-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 170.12 Pln | |
| Ambeed | 10g | 264.69 Pln | |
| Ambeed | 25g | 520.56 Pln | |
| Ambeed | 100g | 1499.56 Pln | |
| Ambeed | 500g | 5882.81 Pln | |
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 136.64 Pln | |
| BLDpharm | 5g | 181.07 Pln | |
| BLDpharm | 10g | 281.04 Pln | |
| BLDpharm | 25g | 553.16 Pln | |
| BLDpharm | 100g | 1608.35 Pln | |
| BLDpharm | 500g | 6334.46 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(3,4,5-trichlorophenyl)boronic acid (CAS 862248-93-9) is a chemical compound with the molecular formula C6H4BCl3O2 and a molecular weight of 225.3 g/mol. IUPAC name: (3,4,5-trichlorophenyl)boronic acid. InChIKey: KTEXVCMJBYWOSG-UHFFFAOYSA-N.
| Molecular formula | C6H4BCl3O2 |
|---|---|
| Molecular weight | 225.3 g/mol |
| IUPAC name | (3,4,5-trichlorophenyl)boronic acid |
| InChIKey | KTEXVCMJBYWOSG-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)Cl)Cl)Cl)(O)O |
Computed by PubChem (NCBI)
Synonyms:
3,4,5-Trichlorophenylboronic acid, (3,4,5-Trichlorophenyl)boronic acid, Boronic acid, (3,4,5-trichlorophenyl)-, (3,4,5-Trichlorophenyl)boronicacid, 3,4,5-trichlorobenzeneboronic acid, KTEXVCMJBYWOSG-UHFFFAOYSA-N, 3,4,5-Trichlorobenzeneboronic Acid (contains varying amounts of Anhydride), 3,4,5-Trichlorophenylboronic Acid (contains varying amounts of Anhydride)