Products 862248-93-9
CAS 862248-93-9 appears in our catalog under these names: 3,4,5-Trichlorophenylboronic Acid, 3,4,5–Trichlorobenzeneboronic Acid (contains varying amounts of Anhydride), 3,4,5-Trichlorophenylboronic Acid (contains varying amounts of Anhydride), (3,4,5-Trichlorophenyl)boronic acid 95%, (3,4,5-Trichlorophenyl)boronic acid, 95%, 95%. Offered by: TRC, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 5g, 100g, 10g, 25g, 1g, 500g, 250mg, 50g.
(3,4,5-trichlorophenyl)boronic acid (CAS 862248-93-9) is a chemical compound with the molecular formula C6H4BCl3O2 and a molecular weight of 225.3 g/mol. IUPAC name: (3,4,5-trichlorophenyl)boronic acid. InChIKey: KTEXVCMJBYWOSG-UHFFFAOYSA-N.
| Molecular formula | C6H4BCl3O2 |
|---|---|
| Molecular weight | 225.3 g/mol |
| IUPAC name | (3,4,5-trichlorophenyl)boronic acid |
| InChIKey | KTEXVCMJBYWOSG-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)Cl)Cl)Cl)(O)O |
Computed by PubChem (NCBI)
Synonyms:
3,4,5-Trichlorophenylboronic acid, (3,4,5-Trichlorophenyl)boronic acid, Boronic acid, (3,4,5-trichlorophenyl)-, (3,4,5-Trichlorophenyl)boronicacid, 3,4,5-trichlorobenzeneboronic acid, KTEXVCMJBYWOSG-UHFFFAOYSA-N, 3,4,5-Trichlorobenzeneboronic Acid (contains varying amounts of Anhydride), 3,4,5-Trichlorophenylboronic Acid (contains varying amounts of Anhydride)