cas: 1704067-18-4 — see every product listed under this CAS number, including other names
(3,4-difluoro-5-morpholinophenyl)boronic acid, 98+% (CAS 1704067-18-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A323515-100mg |
| cas | 1704067-18-4 |
| size | 100mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 2023.00 Pln | |
| AmBeed | 5g | 31044.58 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
(3,4-difluoro-5-morpholin-4-ylphenyl)boronic acid (CAS 1704067-18-4) is a chemical compound with the molecular formula C10H12BF2NO3 and a molecular weight of 243.02 g/mol. IUPAC name: (3,4-difluoro-5-morpholin-4-ylphenyl)boronic acid. InChIKey: UGEHYGVQNISVFA-UHFFFAOYSA-N.
| Molecular formula | C10H12BF2NO3 |
|---|---|
| Molecular weight | 243.02 g/mol |
| IUPAC name | (3,4-difluoro-5-morpholin-4-ylphenyl)boronic acid |
| InChIKey | UGEHYGVQNISVFA-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)F)F)N2CCOCC2)(O)O |
Computed by PubChem (NCBI)