Products 2377609-97-5

CAS 2377609-97-5 appears in our catalog under these names: (2,3-Difluoro-4-morpholinophenyl)boronic acid, 97%, 2,3-Difluoro-4-morpholinophenylboronic acid, 96%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

(2,3-difluoro-4-morpholin-4-ylphenyl)boronic acid (CAS 2377609-97-5) is a chemical compound with the molecular formula C10H12BF2NO3 and a molecular weight of 243.02 g/mol. IUPAC name: (2,3-difluoro-4-morpholin-4-ylphenyl)boronic acid. InChIKey: DIFBNSJBFKOGPB-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12BF2NO3
Molecular weight243.02 g/mol
IUPAC name(2,3-difluoro-4-morpholin-4-ylphenyl)boronic acid
InChIKeyDIFBNSJBFKOGPB-UHFFFAOYSA-N
SMILESB(C1=C(C(=C(C=C1)N2CCOCC2)F)F)(O)O

Computed by PubChem (NCBI)