CAS 1704067-18-4 appears in our catalog under these names: (3,4-Difluoro-5-morpholinophenyl)boronic acid, 95%, (3,4-difluoro-5-morpholinophenyl)boronic acid, 98+%, (3,4–Difluoro–5–morpholinophenyl)boronic acid, Boronic acid, B-[3,4-difluoro-5-(4-morpholinyl)phenyl]-, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg.
(3,4-difluoro-5-morpholin-4-ylphenyl)boronic acid (CAS 1704067-18-4) is a chemical compound with the molecular formula C10H12BF2NO3 and a molecular weight of 243.02 g/mol. IUPAC name: (3,4-difluoro-5-morpholin-4-ylphenyl)boronic acid. InChIKey: UGEHYGVQNISVFA-UHFFFAOYSA-N.
| Molecular formula | C10H12BF2NO3 |
|---|---|
| Molecular weight | 243.02 g/mol |
| IUPAC name | (3,4-difluoro-5-morpholin-4-ylphenyl)boronic acid |
| InChIKey | UGEHYGVQNISVFA-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)F)F)N2CCOCC2)(O)O |
Computed by PubChem (NCBI)