cas: 1072951-82-6 — see every product listed under this CAS number, including other names
(3,5-Dibromo-2-fluorophenyl)boronic acid 95% (CAS 1072951-82-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A658889-250mg |
| cas | 1072951-82-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 209.06 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 1115.75 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A658889 |
(3,5-dibromo-2-fluorophenyl)boronic acid (CAS 1072951-82-6) is a chemical compound with the molecular formula C6H4BBr2FO2 and a molecular weight of 297.71 g/mol. IUPAC name: (3,5-dibromo-2-fluorophenyl)boronic acid. InChIKey: IOOXXDZRFJBCLR-UHFFFAOYSA-N.
| Molecular formula | C6H4BBr2FO2 |
|---|---|
| Molecular weight | 297.71 g/mol |
| IUPAC name | (3,5-dibromo-2-fluorophenyl)boronic acid |
| InChIKey | IOOXXDZRFJBCLR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1F)Br)Br)(O)O |
Computed by PubChem (NCBI)