cas: 1451393-36-4 — see every product listed under this CAS number, including other names
(3,5-Dichloro-4-formylphenyl)boronic acid, 98+% (CAS 1451393-36-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A506025-10g |
| cas | 1451393-36-4 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 25374.37 Pln | |
| AmBeed | 25g | 49832.44 Pln | |
| AmBeed | 5g | 14964.88 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
(3,5-dichloro-4-formylphenyl)boronic acid (CAS 1451393-36-4) is a chemical compound with the molecular formula C7H5BCl2O3 and a molecular weight of 218.83 g/mol. IUPAC name: (3,5-dichloro-4-formylphenyl)boronic acid. InChIKey: ISQRJPAWYFKCBK-UHFFFAOYSA-N.
| Molecular formula | C7H5BCl2O3 |
|---|---|
| Molecular weight | 218.83 g/mol |
| IUPAC name | (3,5-dichloro-4-formylphenyl)boronic acid |
| InChIKey | ISQRJPAWYFKCBK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)Cl)C=O)Cl)(O)O |
Computed by PubChem (NCBI)