Products 1451393-36-4

CAS 1451393-36-4 appears in our catalog under these names: 3,5-Dichloro-4-formylphenylboronic acid, 95%, (3,5-Dichloro-4-formylphenyl)boronic acid, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 10g, 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

(3,5-dichloro-4-formylphenyl)boronic acid (CAS 1451393-36-4) is a chemical compound with the molecular formula C7H5BCl2O3 and a molecular weight of 218.83 g/mol. IUPAC name: (3,5-dichloro-4-formylphenyl)boronic acid. InChIKey: ISQRJPAWYFKCBK-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5BCl2O3
Molecular weight218.83 g/mol
IUPAC name(3,5-dichloro-4-formylphenyl)boronic acid
InChIKeyISQRJPAWYFKCBK-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C(=C1)Cl)C=O)Cl)(O)O

Computed by PubChem (NCBI)