CAS 1451393-36-4 appears in our catalog under these names: 3,5-Dichloro-4-formylphenylboronic acid, 3,5-Dichloro-4-formylphenylboronic acid, 95%, (3,5-Dichloro-4-formylphenyl)boronic acid, 98+%. Offered by: Fluorochem, Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg, 10g, 25g.
(3,5-dichloro-4-formylphenyl)boronic acid (CAS 1451393-36-4) is a chemical compound with the molecular formula C7H5BCl2O3 and a molecular weight of 218.83 g/mol. IUPAC name: (3,5-dichloro-4-formylphenyl)boronic acid. InChIKey: ISQRJPAWYFKCBK-UHFFFAOYSA-N.
| Molecular formula | C7H5BCl2O3 |
|---|---|
| Molecular weight | 218.83 g/mol |
| IUPAC name | (3,5-dichloro-4-formylphenyl)boronic acid |
| InChIKey | ISQRJPAWYFKCBK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)Cl)C=O)Cl)(O)O |
Computed by PubChem (NCBI)