Products 1451392-98-5

CAS 1451392-98-5 appears in our catalog under these names: (2,6-Dichloro-4-formylphenyl)boronic acid, 98+%, 2,6-Dichloro-4-formylphenylboronic acid, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 25g, 5g, 10g, 250mg, 1g.

Structural formula: {0} (CAS {1})

(2,6-dichloro-4-formylphenyl)boronic acid (CAS 1451392-98-5) is a chemical compound with the molecular formula C7H5BCl2O3 and a molecular weight of 218.83 g/mol. IUPAC name: (2,6-dichloro-4-formylphenyl)boronic acid. InChIKey: JIIZYKDHZYFDOO-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5BCl2O3
Molecular weight218.83 g/mol
IUPAC name(2,6-dichloro-4-formylphenyl)boronic acid
InChIKeyJIIZYKDHZYFDOO-UHFFFAOYSA-N
SMILESB(C1=C(C=C(C=C1Cl)C=O)Cl)(O)O

Computed by PubChem (NCBI)