CAS 1451392-98-5 appears in our catalog under these names: (2,6-Dichloro-4-formylphenyl)boronic acid, 98+%, 2,6-Dichloro-4-formylphenylboronic acid, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 25g, 5g, 10g, 250mg, 1g.
(2,6-dichloro-4-formylphenyl)boronic acid (CAS 1451392-98-5) is a chemical compound with the molecular formula C7H5BCl2O3 and a molecular weight of 218.83 g/mol. IUPAC name: (2,6-dichloro-4-formylphenyl)boronic acid. InChIKey: JIIZYKDHZYFDOO-UHFFFAOYSA-N.
| Molecular formula | C7H5BCl2O3 |
|---|---|
| Molecular weight | 218.83 g/mol |
| IUPAC name | (2,6-dichloro-4-formylphenyl)boronic acid |
| InChIKey | JIIZYKDHZYFDOO-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1Cl)C=O)Cl)(O)O |
Computed by PubChem (NCBI)