cas: 2377605-67-7 — see every product listed under this CAS number, including other names
(3,6-Dichloro-2-fluorophenyl)boronic acid 98% (CAS 2377605-67-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A763894-1g |
| cas | 2377605-67-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 698.56 Pln | |
| Ambeed | 5g | 1744.31 Pln | |
| Ambeed | 10g | 2584.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A763894 |
(3,6-dichloro-2-fluorophenyl)boronic acid (CAS 2377605-67-7) is a chemical compound with the molecular formula C6H4BCl2FO2 and a molecular weight of 208.81 g/mol. IUPAC name: (3,6-dichloro-2-fluorophenyl)boronic acid. InChIKey: DUQQOHAKWSAPPK-UHFFFAOYSA-N.
| Molecular formula | C6H4BCl2FO2 |
|---|---|
| Molecular weight | 208.81 g/mol |
| IUPAC name | (3,6-dichloro-2-fluorophenyl)boronic acid |
| InChIKey | DUQQOHAKWSAPPK-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1F)Cl)Cl)(O)O |
Computed by PubChem (NCBI)