Products 1646614-31-4
CAS 1646614-31-4 appears in our catalog under these names: 3,5-Dichloro-4-fluorophenylboronic acid, 3,5-Dichloro-4-fluorophenylboronic acid, 98%, 3,5-Dichloro-4-fluorophenylboronic acid 98%, 3,5-Dichloro-4-fluorophenylboronic acid, 98%, 98%, (3,5-Dichloro-4-fluorophenyl)boronic acid, 97%. Offered by: Biosynth, Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 2,5g, 5g, 10g, 25g, 1g, 100mg, 250mg.
(3,5-dichloro-4-fluorophenyl)boronic acid (CAS 1646614-31-4) is a chemical compound with the molecular formula C6H4BCl2FO2 and a molecular weight of 208.81 g/mol. IUPAC name: (3,5-dichloro-4-fluorophenyl)boronic acid. InChIKey: OKZYLWQCOUTIMV-UHFFFAOYSA-N.
| Molecular formula | C6H4BCl2FO2 |
|---|---|
| Molecular weight | 208.81 g/mol |
| IUPAC name | (3,5-dichloro-4-fluorophenyl)boronic acid |
| InChIKey | OKZYLWQCOUTIMV-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)Cl)F)Cl)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(3,5-dichloro-4-fluorophenyl)boronic acid, 3,5-Dichloro-4-fluorophenylboronic acid, 3,5-Dichloro-4-fluorophenylboronic acid(contains varying amounts of Anhydride), 3,5-Dichloro-4-fluorophenylboronicacid, (3,5-dichloro-4-fluoro-phenyl)boronic acid, B-(3,5-dichloro-4-fluorophenyl)boronic acid, Boronic acid, B-(3,5-dichloro-4-fluorophenyl)-, (3,5-Dichloro-4-fluorophenyl)boronic acid - [D89266]