Products 2377605-67-7
CAS 2377605-67-7 appears in our catalog under these names: (3,6-Dichloro-2-fluorophenyl)boronic acid, 98%, (3,6-Dichloro-2-fluorophenyl)boronic acid 98%, (3,6-Dichloro-2-fluorophenyl)boronic acid, 98%, 98%, (3,6-Dichloro-2-fluorophenyl)boronic acid. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g.
(3,6-dichloro-2-fluorophenyl)boronic acid (CAS 2377605-67-7) is a chemical compound with the molecular formula C6H4BCl2FO2 and a molecular weight of 208.81 g/mol. IUPAC name: (3,6-dichloro-2-fluorophenyl)boronic acid. InChIKey: DUQQOHAKWSAPPK-UHFFFAOYSA-N.
| Molecular formula | C6H4BCl2FO2 |
|---|---|
| Molecular weight | 208.81 g/mol |
| IUPAC name | (3,6-dichloro-2-fluorophenyl)boronic acid |
| InChIKey | DUQQOHAKWSAPPK-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1F)Cl)Cl)(O)O |
Computed by PubChem (NCBI)