(3-(Dimethylcarbamoyl)-4-fluorophenyl)boronic acid, 98%
cas: 874219-27-9 — see every product listed under this CAS number, including other names
(3-(Dimethylcarbamoyl)-4-fluorophenyl)boronic acid, 98% (CAS 874219-27-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A559487-100mg |
| cas | 874219-27-9 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 248.00 Pln | |
| Ambeed | 250mg | 337.00 Pln | |
| Ambeed | 1g | 759.75 Pln | |
| Ambeed | 5g | 2506.38 Pln | |
| BLDpharm | 100mg | 258.82 Pln | |
| BLDpharm | 250mg | 353.23 Pln | |
| BLDpharm | 1g | 814.18 Pln | |
| BLDpharm | 5g | 2696.85 Pln | |
| Fluorochem | 250mg | 482.14 Pln | |
| Fluorochem | 1g | 1148.57 Pln | |
| Fluorochem | 100mg | 404.04 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
[3-(dimethylcarbamoyl)-4-fluorophenyl]boronic acid (CAS 874219-27-9) is a chemical compound with the molecular formula C9H11BFNO3 and a molecular weight of 211.00 g/mol. IUPAC name: [3-(dimethylcarbamoyl)-4-fluorophenyl]boronic acid. InChIKey: CRXFXVKQLCHKSK-UHFFFAOYSA-N.
| Molecular formula | C9H11BFNO3 |
|---|---|
| Molecular weight | 211.00 g/mol |
| IUPAC name | [3-(dimethylcarbamoyl)-4-fluorophenyl]boronic acid |
| InChIKey | CRXFXVKQLCHKSK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)F)C(=O)N(C)C)(O)O |
Computed by PubChem (NCBI)
Synonyms:
3-(Dimethylcarbamoyl)-4-fluorobenzeneboronic acid, (3-(Dimethylcarbamoyl)-4-fluorophenyl)boronic acid, 3-(Dimethylcarbamoyl)-4-fluorophenylboronic acid, [3-(dimethylcarbamoyl)-4-fluorophenyl]boronic acid, 4-Fluoro-3-(dimethylcarbamoyl)phenylboronic acid, [3-(Dimethylcarbamoyl)-4-fluoro-phenyl]boronic acid, 3-Dimethylaminocarbonyl-4-fluorophenylboronic acid, CRXFXVKQLCHKSK-UHFFFAOYSA-N, (3-(Dimethylcarbamoyl)-4-fluorophenyl)boronicacid