Products 874289-30-2
CAS 874289-30-2 appears in our catalog under these names: 4-(Dimethylcarbamoyl)-2-fluorophenylboronic acid, 98%, (4–(Dimethylcarbamoyl)–2–fluorophenyl)boronic acid, (4-(Dimethylcarbamoyl)-2-fluorophenyl)boronic acid 97%, (4-(Dimethylcarbamoyl)-2-fluorophenyl)boronic acid, 96%. Offered by: Combi-blocks, GLPBio, Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 200mg, 100mg.
[4-(dimethylcarbamoyl)-2-fluorophenyl]boronic acid (CAS 874289-30-2) is a chemical compound with the molecular formula C9H11BFNO3 and a molecular weight of 211.00 g/mol. IUPAC name: [4-(dimethylcarbamoyl)-2-fluorophenyl]boronic acid. InChIKey: IOTCMPCBVDPZTB-UHFFFAOYSA-N.
| Molecular formula | C9H11BFNO3 |
|---|---|
| Molecular weight | 211.00 g/mol |
| IUPAC name | [4-(dimethylcarbamoyl)-2-fluorophenyl]boronic acid |
| InChIKey | IOTCMPCBVDPZTB-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C(=O)N(C)C)F)(O)O |
Computed by PubChem (NCBI)