CAS 874219-27-9 appears in our catalog under these names: 3-(Dimethylcarbamoyl)-4-fluorophenylboronic acid, 98%, 3–Dimethylcarbamoyl–4–fluorobenzeneboronic acid, (3-(Dimethylcarbamoyl)-4-fluorophenyl)boronic acid, 95%, 95%, (3-(Dimethylcarbamoyl)-4-fluorophenyl)boronic acid, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 500mg, 250mg, 100mg.
[3-(dimethylcarbamoyl)-4-fluorophenyl]boronic acid (CAS 874219-27-9) is a chemical compound with the molecular formula C9H11BFNO3 and a molecular weight of 211.00 g/mol. IUPAC name: [3-(dimethylcarbamoyl)-4-fluorophenyl]boronic acid. InChIKey: CRXFXVKQLCHKSK-UHFFFAOYSA-N.
| Molecular formula | C9H11BFNO3 |
|---|---|
| Molecular weight | 211.00 g/mol |
| IUPAC name | [3-(dimethylcarbamoyl)-4-fluorophenyl]boronic acid |
| InChIKey | CRXFXVKQLCHKSK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)F)C(=O)N(C)C)(O)O |
Computed by PubChem (NCBI)