cas: 874219-20-2 — see every product listed under this CAS number, including other names
(3-(Ethylcarbamoyl)-4-fluorophenyl)boronic acid, 95% (CAS 874219-20-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F219681-250MG |
| cas | 874219-20-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 299.91 Pln | |
| Fluorochem | 1g | 659.16 Pln | |
| Fluorochem | 5g | 2132.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
[3-(ethylcarbamoyl)-4-fluorophenyl]boronic acid (CAS 874219-20-2) is a chemical compound with the molecular formula C9H11BFNO3 and a molecular weight of 211.00 g/mol. IUPAC name: [3-(ethylcarbamoyl)-4-fluorophenyl]boronic acid. InChIKey: BAEYNRHYQQRDHO-UHFFFAOYSA-N.
| Molecular formula | C9H11BFNO3 |
|---|---|
| Molecular weight | 211.00 g/mol |
| IUPAC name | [3-(ethylcarbamoyl)-4-fluorophenyl]boronic acid |
| InChIKey | BAEYNRHYQQRDHO-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)F)C(=O)NCC)(O)O |
Computed by PubChem (NCBI)