cas: 2096338-40-6 — see every product listed under this CAS number, including other names
(3-(N-(P-TOLYL)SULFAMOYL)PHENYL)BORONIC ACID, 97% (CAS 2096338-40-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F844412-100MG |
| cas | 2096338-40-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1091.30 Pln | |
| Fluorochem | 250mg | 1768.15 Pln | |
| Fluorochem | 1g | 4506.76 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
[3-[(4-methylphenyl)sulfamoyl]phenyl]boronic acid (CAS 2096338-40-6) is a chemical compound with the molecular formula C13H14BNO4S and a molecular weight of 291.1 g/mol. IUPAC name: [3-[(4-methylphenyl)sulfamoyl]phenyl]boronic acid. InChIKey: GRQHTWKGKZUQNA-UHFFFAOYSA-N.
| Molecular formula | C13H14BNO4S |
|---|---|
| Molecular weight | 291.1 g/mol |
| IUPAC name | [3-[(4-methylphenyl)sulfamoyl]phenyl]boronic acid |
| InChIKey | GRQHTWKGKZUQNA-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)S(=O)(=O)NC2=CC=C(C=C2)C)(O)O |
Computed by PubChem (NCBI)