CAS 1449131-68-3 appears in our catalog under these names: 4-(3-Methylphenylsulfamoyl)benzeneboronic acid, 95%, B–(4–(((3–methylphenyl)amino)sulfonyl)phenyl)Boronic acid, (4-(N-(m-tolyl)sulfamoyl)phenyl)boronic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 100mg, 1g, 250mg.
[4-[(3-methylphenyl)sulfamoyl]phenyl]boronic acid (CAS 1449131-68-3) is a chemical compound with the molecular formula C13H14BNO4S and a molecular weight of 291.1 g/mol. IUPAC name: [4-[(3-methylphenyl)sulfamoyl]phenyl]boronic acid. InChIKey: KKNWGIFWNSPQMK-UHFFFAOYSA-N.
| Molecular formula | C13H14BNO4S |
|---|---|
| Molecular weight | 291.1 g/mol |
| IUPAC name | [4-[(3-methylphenyl)sulfamoyl]phenyl]boronic acid |
| InChIKey | KKNWGIFWNSPQMK-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)S(=O)(=O)NC2=CC=CC(=C2)C)(O)O |
Computed by PubChem (NCBI)