cas: 850568-45-5 — see every product listed under this CAS number, including other names
(3-Amino-4-chlorophenyl)boronic acid hydrochloride (CAS 850568-45-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F219665-5G |
| cas | 850568-45-5 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 2111.77 Pln | |
| Fluorochem | 10g | 3543.56 Pln |
| delivery time | 3-4 weeks |
|---|
(3-amino-4-chlorophenyl)boronic acid;hydrochloride (CAS 850568-45-5) is a chemical compound with the molecular formula C6H8BCl2NO2 and a molecular weight of 207.85 g/mol. IUPAC name: (3-amino-4-chlorophenyl)boronic acid;hydrochloride. InChIKey: MTMLYYSBEQYCDJ-UHFFFAOYSA-N.
| Molecular formula | C6H8BCl2NO2 |
|---|---|
| Molecular weight | 207.85 g/mol |
| IUPAC name | (3-amino-4-chlorophenyl)boronic acid;hydrochloride |
| InChIKey | MTMLYYSBEQYCDJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)Cl)N)(O)O.Cl |
Computed by PubChem (NCBI)