Products 2096340-32-6

CAS 2096340-32-6 is the registry number for 5-Amino-2-chlorophenylboronic acid hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

(5-amino-2-chlorophenyl)boronic acid;hydrochloride (CAS 2096340-32-6) is a chemical compound with the molecular formula C6H8BCl2NO2 and a molecular weight of 207.85 g/mol. IUPAC name: (5-amino-2-chlorophenyl)boronic acid;hydrochloride. InChIKey: LZLUPPGYAMRAPF-UHFFFAOYSA-N.

Identity
Molecular formulaC6H8BCl2NO2
Molecular weight207.85 g/mol
IUPAC name(5-amino-2-chlorophenyl)boronic acid;hydrochloride
InChIKeyLZLUPPGYAMRAPF-UHFFFAOYSA-N
SMILESB(C1=C(C=CC(=C1)N)Cl)(O)O.Cl

Computed by PubChem (NCBI)