CAS 2377608-36-9 is the registry number for (2-Amino-5-chlorophenyl)boronic acid hydrochloride, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(2-amino-5-chlorophenyl)boronic acid;hydrochloride (CAS 2377608-36-9) is a chemical compound with the molecular formula C6H8BCl2NO2 and a molecular weight of 207.85 g/mol. IUPAC name: (2-amino-5-chlorophenyl)boronic acid;hydrochloride. InChIKey: HCXBRETYDMGULS-UHFFFAOYSA-N.
| Molecular formula | C6H8BCl2NO2 |
|---|---|
| Molecular weight | 207.85 g/mol |
| IUPAC name | (2-amino-5-chlorophenyl)boronic acid;hydrochloride |
| InChIKey | HCXBRETYDMGULS-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)Cl)N)(O)O.Cl |
Computed by PubChem (NCBI)