cas: 849052-18-2 — see every product listed under this CAS number, including other names
(3-Bromo-2-((4-chlorobenzyl)oxy)-5-methylphenyl)boronic acid 97% (CAS 849052-18-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A907516-100mg |
| cas | 849052-18-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 181.25 Pln | |
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 314.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A907516 |
[3-bromo-2-[(4-chlorophenyl)methoxy]-5-methylphenyl]boronic acid (CAS 849052-18-2) is a chemical compound with the molecular formula C14H13BBrClO3 and a molecular weight of 355.42 g/mol. IUPAC name: [3-bromo-2-[(4-chlorophenyl)methoxy]-5-methylphenyl]boronic acid. InChIKey: DKUPKFVGBUWCOP-UHFFFAOYSA-N.
| Molecular formula | C14H13BBrClO3 |
|---|---|
| Molecular weight | 355.42 g/mol |
| IUPAC name | [3-bromo-2-[(4-chlorophenyl)methoxy]-5-methylphenyl]boronic acid |
| InChIKey | DKUPKFVGBUWCOP-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1OCC2=CC=C(C=C2)Cl)Br)C)(O)O |
Computed by PubChem (NCBI)