cas: 1177559-63-5 — see every product listed under this CAS number, including other names
(3-Bromo-2-fluorophenyl)methanamine HCl 95% (CAS 1177559-63-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A135936-100mg |
| cas | 1177559-63-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 570.62 Pln | |
| Ambeed | 5g | 1911.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A135936 |
(3-bromo-2-fluorophenyl)methanamine;hydrochloride (CAS 1177559-63-5) is a chemical compound with the molecular formula C7H8BrClFN and a molecular weight of 240.50 g/mol. IUPAC name: (3-bromo-2-fluorophenyl)methanamine;hydrochloride. InChIKey: UESRHZRMSFJHEY-UHFFFAOYSA-N.
| Molecular formula | C7H8BrClFN |
|---|---|
| Molecular weight | 240.50 g/mol |
| IUPAC name | (3-bromo-2-fluorophenyl)methanamine;hydrochloride |
| InChIKey | UESRHZRMSFJHEY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)F)CN.Cl |
Computed by PubChem (NCBI)