cas: 1177559-63-5 — see every product listed under this CAS number, including other names
(3-Bromo-2-fluorophenyl)methanamine hydrochloride, 95%, 95% (CAS 1177559-63-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1192FL-100mg |
| cas | 1177559-63-5 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 203.60 Pln | |
| Chemat | 1g | 530.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(3-bromo-2-fluorophenyl)methanamine;hydrochloride (CAS 1177559-63-5) is a chemical compound with the molecular formula C7H8BrClFN and a molecular weight of 240.50 g/mol. IUPAC name: (3-bromo-2-fluorophenyl)methanamine;hydrochloride. InChIKey: UESRHZRMSFJHEY-UHFFFAOYSA-N.
| Molecular formula | C7H8BrClFN |
|---|---|
| Molecular weight | 240.50 g/mol |
| IUPAC name | (3-bromo-2-fluorophenyl)methanamine;hydrochloride |
| InChIKey | UESRHZRMSFJHEY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)F)CN.Cl |
Computed by PubChem (NCBI)