cas: 870718-01-7 — see every product listed under this CAS number, including other names
(3-Bromo-2-isopropoxy-5-methylphenyl)boronic acid 97% (CAS 870718-01-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A795873-250mg |
| cas | 870718-01-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 1277.06 Pln | |
| Ambeed | 25g | 4286.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A795873 |
(3-bromo-5-methyl-2-propan-2-yloxyphenyl)boronic acid (CAS 870718-01-7) is a chemical compound with the molecular formula C10H14BBrO3 and a molecular weight of 272.93 g/mol. IUPAC name: (3-bromo-5-methyl-2-propan-2-yloxyphenyl)boronic acid. InChIKey: VTDMHYFQQWORBC-UHFFFAOYSA-N.
| Molecular formula | C10H14BBrO3 |
|---|---|
| Molecular weight | 272.93 g/mol |
| IUPAC name | (3-bromo-5-methyl-2-propan-2-yloxyphenyl)boronic acid |
| InChIKey | VTDMHYFQQWORBC-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1OC(C)C)Br)C)(O)O |
Computed by PubChem (NCBI)