Products 918904-39-9
CAS 918904-39-9 appears in our catalog under these names: 3-Bromo-5-isobutoxyphenylboronic acid, 98%, (3-Bromo-5-isobutoxyphenyl)boronic acid 98%, 3-Bromo-5-isobutoxyphenylboronic acid, 98%, 98%, (3-Bromo-5-isobutoxyphenyl)boronic acid. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 100g, 1g.
[3-bromo-5-(2-methylpropoxy)phenyl]boronic acid (CAS 918904-39-9) is a chemical compound with the molecular formula C10H14BBrO3 and a molecular weight of 272.93 g/mol. IUPAC name: [3-bromo-5-(2-methylpropoxy)phenyl]boronic acid. InChIKey: IXGHRDWYMOJQRZ-UHFFFAOYSA-N.
| Molecular formula | C10H14BBrO3 |
|---|---|
| Molecular weight | 272.93 g/mol |
| IUPAC name | [3-bromo-5-(2-methylpropoxy)phenyl]boronic acid |
| InChIKey | IXGHRDWYMOJQRZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)Br)OCC(C)C)(O)O |
Computed by PubChem (NCBI)