CAS 480425-34-1 appears in our catalog under these names: 3-Bromo-2-butoxyphenylboronic acid, 98%, 3-Bromo-2-butoxyphenylboronic acid, ≥97%, ≥97%, (3-Bromo-2-butoxyphenyl)boronic acid, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 250mg.
(3-bromo-2-butoxyphenyl)boronic acid (CAS 480425-34-1) is a chemical compound with the molecular formula C10H14BBrO3 and a molecular weight of 272.93 g/mol. IUPAC name: (3-bromo-2-butoxyphenyl)boronic acid. InChIKey: HKYOOGBELZHMIS-UHFFFAOYSA-N.
| Molecular formula | C10H14BBrO3 |
|---|---|
| Molecular weight | 272.93 g/mol |
| IUPAC name | (3-bromo-2-butoxyphenyl)boronic acid |
| InChIKey | HKYOOGBELZHMIS-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)Br)OCCCC)(O)O |
Computed by PubChem (NCBI)