cas: 1109791-90-3 — see every product listed under this CAS number, including other names
(3-Bromo-4-methoxyphenyl)boronic acid 96% (CAS 1109791-90-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A918319-100mg |
| cas | 1109791-90-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 387.06 Pln | |
| Ambeed | 250mg | 631.81 Pln | |
| Ambeed | 1g | 1583.00 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A918319 |
(3-bromo-4-methoxyphenyl)boronic acid (CAS 1109791-90-3) is a chemical compound with the molecular formula C7H8BBrO3 and a molecular weight of 230.85 g/mol. IUPAC name: (3-bromo-4-methoxyphenyl)boronic acid. InChIKey: LTFQTEKWUJUYEN-UHFFFAOYSA-N.
| Molecular formula | C7H8BBrO3 |
|---|---|
| Molecular weight | 230.85 g/mol |
| IUPAC name | (3-bromo-4-methoxyphenyl)boronic acid |
| InChIKey | LTFQTEKWUJUYEN-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OC)Br)(O)O |
Computed by PubChem (NCBI)