cas: 1109791-90-3 — see every product listed under this CAS number, including other names
(3-Bromo-4-methoxyphenyl)boronic acid, 97%, 97% (CAS 1109791-90-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11KWAW-1g |
| cas | 1109791-90-3 |
| size | 1g |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1005.20 Pln | |
| Chemat | 100mg | 261.20 Pln | |
| Chemat | 250mg | 410.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(3-bromo-4-methoxyphenyl)boronic acid (CAS 1109791-90-3) is a chemical compound with the molecular formula C7H8BBrO3 and a molecular weight of 230.85 g/mol. IUPAC name: (3-bromo-4-methoxyphenyl)boronic acid. InChIKey: LTFQTEKWUJUYEN-UHFFFAOYSA-N.
| Molecular formula | C7H8BBrO3 |
|---|---|
| Molecular weight | 230.85 g/mol |
| IUPAC name | (3-bromo-4-methoxyphenyl)boronic acid |
| InChIKey | LTFQTEKWUJUYEN-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OC)Br)(O)O |
Computed by PubChem (NCBI)