CAS 1879166-84-3 appears in our catalog under these names: 2-Bromo-4-methoxyphenylboronic acid, 95%, (2-bromo-4-methoxyphenyl)boronicacid, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg, 100mg.
(2-bromo-4-methoxyphenyl)boronic acid (CAS 1879166-84-3) is a chemical compound with the molecular formula C7H8BBrO3 and a molecular weight of 230.85 g/mol. IUPAC name: (2-bromo-4-methoxyphenyl)boronic acid. InChIKey: IYAGASZZPOEXPZ-UHFFFAOYSA-N.
| Molecular formula | C7H8BBrO3 |
|---|---|
| Molecular weight | 230.85 g/mol |
| IUPAC name | (2-bromo-4-methoxyphenyl)boronic acid |
| InChIKey | IYAGASZZPOEXPZ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)OC)Br)(O)O |
Computed by PubChem (NCBI)