cas: 1072951-84-8 — see every product listed under this CAS number, including other names
(3-Bromo-5-butoxyphenyl)boronic acid (CAS 1072951-84-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F212588-1G |
| cas | 1072951-84-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 414.46 Pln | |
| Fluorochem | 5g | 1268.32 Pln | |
| Fluorochem | 10g | 2465.82 Pln |
| delivery time | 3-4 weeks |
|---|
(3-bromo-5-butoxyphenyl)boronic acid (CAS 1072951-84-8) is a chemical compound with the molecular formula C10H14BBrO3 and a molecular weight of 272.93 g/mol. IUPAC name: (3-bromo-5-butoxyphenyl)boronic acid. InChIKey: OWWZXOTWNAQSTF-UHFFFAOYSA-N.
| Molecular formula | C10H14BBrO3 |
|---|---|
| Molecular weight | 272.93 g/mol |
| IUPAC name | (3-bromo-5-butoxyphenyl)boronic acid |
| InChIKey | OWWZXOTWNAQSTF-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)Br)OCCCC)(O)O |
Computed by PubChem (NCBI)