cas: 918904-39-9 — see every product listed under this CAS number, including other names
(3-Bromo-5-isobutoxyphenyl)boronic acid (CAS 918904-39-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F212589-1G |
| cas | 918904-39-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 174.96 Pln | |
| Fluorochem | 5g | 419.66 Pln | |
| Fluorochem | 25g | 1091.30 Pln |
| delivery time | 2-3 weeks |
|---|
[3-bromo-5-(2-methylpropoxy)phenyl]boronic acid (CAS 918904-39-9) is a chemical compound with the molecular formula C10H14BBrO3 and a molecular weight of 272.93 g/mol. IUPAC name: [3-bromo-5-(2-methylpropoxy)phenyl]boronic acid. InChIKey: IXGHRDWYMOJQRZ-UHFFFAOYSA-N.
| Molecular formula | C10H14BBrO3 |
|---|---|
| Molecular weight | 272.93 g/mol |
| IUPAC name | [3-bromo-5-(2-methylpropoxy)phenyl]boronic acid |
| InChIKey | IXGHRDWYMOJQRZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)Br)OCC(C)C)(O)O |
Computed by PubChem (NCBI)