(3-Bromo-5-nitrophenyl)hydrazine hydrochloride, 98%
cas: 2407751-62-4 — see every product listed under this CAS number, including other names
(3-Bromo-5-nitrophenyl)hydrazine hydrochloride, 98% (CAS 2407751-62-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F982901-100MG |
| cas | 2407751-62-4 |
| size | 100mg |
| availability | In Stock Germany |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 247.85 Pln | |
| Fluorochem | 250mg | 419.66 Pln | |
| Fluorochem | 1g | 992.38 Pln | |
| Fluorochem | 5g | 4418.25 Pln | |
| Fluorochem | 10g | 8323.13 Pln | |
| Ambeed | 100mg | 231.31 Pln | |
| Ambeed | 250mg | 375.94 Pln | |
| Ambeed | 1g | 876.56 Pln | |
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 250mg | 304.40 Pln | |
| Chemat | 1g | 693.20 Pln | |
| BLDpharm | 100mg | 247.72 Pln | |
| BLDpharm | 250mg | 403.22 Pln | |
| BLDpharm | 1g | 936.36 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
(3-bromo-5-nitrophenyl)hydrazine;hydrochloride (CAS 2407751-62-4) is a chemical compound with the molecular formula C6H7BrClN3O2 and a molecular weight of 268.49 g/mol. IUPAC name: (3-bromo-5-nitrophenyl)hydrazine;hydrochloride. InChIKey: ZWIMXGXMVNYPSS-UHFFFAOYSA-N.
| Molecular formula | C6H7BrClN3O2 |
|---|---|
| Molecular weight | 268.49 g/mol |
| IUPAC name | (3-bromo-5-nitrophenyl)hydrazine;hydrochloride |
| InChIKey | ZWIMXGXMVNYPSS-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1[N+](=O)[O-])Br)NN.Cl |
Computed by PubChem (NCBI)