CAS 100032-79-9 appears in our catalog under these names: 4-Bromo-2-nitrophenylhydrazine hydrochloride, 95%, (4-Bromo-2-nitrophenyl)hydrazine hydrochloride, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 5g.
(4-bromo-2-nitrophenyl)hydrazine;hydrochloride (CAS 100032-79-9) is a chemical compound with the molecular formula C6H7BrClN3O2 and a molecular weight of 268.49 g/mol. IUPAC name: (4-bromo-2-nitrophenyl)hydrazine;hydrochloride. InChIKey: SIBURLORIWZQNT-UHFFFAOYSA-N.
| Molecular formula | C6H7BrClN3O2 |
|---|---|
| Molecular weight | 268.49 g/mol |
| IUPAC name | (4-bromo-2-nitrophenyl)hydrazine;hydrochloride |
| InChIKey | SIBURLORIWZQNT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)[N+](=O)[O-])NN.Cl |
Computed by PubChem (NCBI)