CAS 2407751-62-4 appears in our catalog under these names: (3-Bromo-5-nitrophenyl)hydrazine hydrochloride, 98%, 98%, (3-Bromo-5-nitrophenyl)hydrazine hydrochloride, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
(3-bromo-5-nitrophenyl)hydrazine;hydrochloride (CAS 2407751-62-4) is a chemical compound with the molecular formula C6H7BrClN3O2 and a molecular weight of 268.49 g/mol. IUPAC name: (3-bromo-5-nitrophenyl)hydrazine;hydrochloride. InChIKey: ZWIMXGXMVNYPSS-UHFFFAOYSA-N.
| Molecular formula | C6H7BrClN3O2 |
|---|---|
| Molecular weight | 268.49 g/mol |
| IUPAC name | (3-bromo-5-nitrophenyl)hydrazine;hydrochloride |
| InChIKey | ZWIMXGXMVNYPSS-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1[N+](=O)[O-])Br)NN.Cl |
Computed by PubChem (NCBI)