cas: 20017-68-9 — see every product listed under this CAS number, including other names
(3-Bromopropane-1,1-diyl)dibenzene, 98%, 98% (CAS 20017-68-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113CLJ-100mg |
| cas | 20017-68-9 |
| size | 100mg |
| availability | 48g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 141.20 Pln | |
| Chemat | 1g | 198.80 Pln | |
| Chemat | 5g | 602.00 Pln | |
| Chemat | 10g | 1000.40 Pln | |
| Chemat | 25g | 1979.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(3-bromo-1-phenylpropyl)benzene (CAS 20017-68-9) is a chemical compound with the molecular formula C15H15Br and a molecular weight of 275.18 g/mol. IUPAC name: (3-bromo-1-phenylpropyl)benzene. InChIKey: SLHSRCBFPHCSGL-UHFFFAOYSA-N.
| Molecular formula | C15H15Br |
|---|---|
| Molecular weight | 275.18 g/mol |
| IUPAC name | (3-bromo-1-phenylpropyl)benzene |
| InChIKey | SLHSRCBFPHCSGL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CCBr)C2=CC=CC=C2 |
Computed by PubChem (NCBI)